CAS 25462-90-2 is the registry number for Ethyl 2-bromo-6-methylisonicotinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-bromo-6-methylpyridine-4-carboxylate (CAS 25462-90-2) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: ethyl 2-bromo-6-methylpyridine-4-carboxylate. InChIKey: COYYSMAYSSRSFU-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | ethyl 2-bromo-6-methylpyridine-4-carboxylate |
| InChIKey | COYYSMAYSSRSFU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=NC(=C1)C)Br |
Computed by PubChem (NCBI)