CAS 25476-44-2 appears in our catalog under these names: 2-(1,3-Dioxaindan-5-yl)propanoic acid, 2-(1,3-Dioxaindan-5-yl)propanoic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 500mg, 1g.
2-(1,3-benzodioxol-5-yl)propanoic acid (CAS 25476-44-2) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-yl)propanoic acid. InChIKey: VUNWUTPFVAAMOC-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-yl)propanoic acid |
| InChIKey | VUNWUTPFVAAMOC-UHFFFAOYSA-N |
| SMILES | CC(C1=CC2=C(C=C1)OCO2)C(=O)O |
Computed by PubChem (NCBI)