CAS 877171-11-4 is the registry number for (S)-2-(Benzo(D)(1,3)dioxol-5-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2S)-2-(1,3-benzodioxol-5-yl)propanoic acid (CAS 877171-11-4) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: (2S)-2-(1,3-benzodioxol-5-yl)propanoic acid. InChIKey: VUNWUTPFVAAMOC-LURJTMIESA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | (2S)-2-(1,3-benzodioxol-5-yl)propanoic acid |
| InChIKey | VUNWUTPFVAAMOC-LURJTMIESA-N |
| SMILES | C[C@@H](C1=CC2=C(C=C1)OCO2)C(=O)O |
Computed by PubChem (NCBI)