Products 2548-47-2
CAS 2548-47-2 is the registry number for 2,3-Diphenyl-1,3-butadiene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-phenylbuta-1,3-dien-2-ylbenzene (CAS 2548-47-2) is a chemical compound with the molecular formula C16H14 and a molecular weight of 206.28 g/mol. IUPAC name: 3-phenylbuta-1,3-dien-2-ylbenzene. InChIKey: LGLDSEPDYUTBNZ-UHFFFAOYSA-N.
| Molecular formula | C16H14 |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | 3-phenylbuta-1,3-dien-2-ylbenzene |
| InChIKey | LGLDSEPDYUTBNZ-UHFFFAOYSA-N |
| SMILES | C=C(C1=CC=CC=C1)C(=C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
2,3-diphenylbuta-1,3-diene, 2,3-Diphenyl-1,3-butadiene, 3-phenylbuta-1,3-dien-2-ylbenzene, Buta-1,3-diene-2,3-diyldibenzene, 1,1'-[1,2-bis(methylene)-1,2-ethanediyl]bis-Benzene, LGLDSEPDYUTBNZ-UHFFFAOYSA-N, (1-methylene-2-phenyl-prop-2-enyl)-benzene, 1,1'-(Buta-1,3-diene-2,3-diyl)dibenzene