CAS 2550906-64-2 appears in our catalog under these names: N-Fmoc-N-methyl-(S)-2- propargylglycine, 98%, N-Fmoc-N-methyl-(S)-2-propargylglycine, ≥95%, ≥95%, Fmoc-N-Me-Gly(propargyl)-OH, 98%. Offered by: Fluorochem, Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g.
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]pent-4-ynoic acid (CAS 2550906-64-2) is a chemical compound with the molecular formula C21H19NO4 and a molecular weight of 349.4 g/mol. IUPAC name: (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]pent-4-ynoic acid. InChIKey: WBJWNESNVRWMEI-IBGZPJMESA-N.
| Molecular formula | C21H19NO4 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]pent-4-ynoic acid |
| InChIKey | WBJWNESNVRWMEI-IBGZPJMESA-N |
| SMILES | CN([C@@H](CC#C)C(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)