CAS 25570-02-9 appears in our catalog under these names: 3,3',5,5'-Tetramethylbiphenyl, 95%, 3,3',5,5'–Tetramethylbiphenyl, 3,3',5,5'-Tetramethylbiphenyl, 97+% , 3,3',5,5'-Tetramethylbiphenyl, >98.0%(GC), 3,3',5,5'-tetramethylbiphenyl, 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Fluorochem. Available pack sizes: 1g, 5g, 200mg, 1x100mg.
1-(3,5-dimethylphenyl)-3,5-dimethylbenzene (CAS 25570-02-9) is a chemical compound with the molecular formula C16H18 and a molecular weight of 210.31 g/mol. IUPAC name: 1-(3,5-dimethylphenyl)-3,5-dimethylbenzene. InChIKey: CMZYGFLOKOQMKF-UHFFFAOYSA-N.
| Molecular formula | C16H18 |
|---|---|
| Molecular weight | 210.31 g/mol |
| IUPAC name | 1-(3,5-dimethylphenyl)-3,5-dimethylbenzene |
| InChIKey | CMZYGFLOKOQMKF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C2=CC(=CC(=C2)C)C)C |
Computed by PubChem (NCBI)