CAS 3075-84-1 appears in our catalog under these names: 2,2',5,5'-Tetramethylbiphenyl, 95%, 2,2',5,5'–Tetramethylbiphenyl, 2,2',5,5'-Tetramethylbiphenyl, 98% , 2,2',5,5'-Tetramethylbiphenyl, 2,2',5,5'-tetramethylbiphenyl, 97%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
2-(2,5-dimethylphenyl)-1,4-dimethylbenzene (CAS 3075-84-1) is a chemical compound with the molecular formula C16H18 and a molecular weight of 210.31 g/mol. IUPAC name: 2-(2,5-dimethylphenyl)-1,4-dimethylbenzene. InChIKey: ZHTROMYSDSTCCE-UHFFFAOYSA-N.
| Molecular formula | C16H18 |
|---|---|
| Molecular weight | 210.31 g/mol |
| IUPAC name | 2-(2,5-dimethylphenyl)-1,4-dimethylbenzene |
| InChIKey | ZHTROMYSDSTCCE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)C2=C(C=CC(=C2)C)C |
Computed by PubChem (NCBI)