Products 3976-37-2

CAS 3976-37-2 is the registry number for 2,4,4',6-Tetramethylbiphenyl, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.

Structural formula: {0} (CAS {1})

1,3,5-trimethyl-2-(4-methylphenyl)benzene (CAS 3976-37-2) is a chemical compound with the molecular formula C16H18 and a molecular weight of 210.31 g/mol. IUPAC name: 1,3,5-trimethyl-2-(4-methylphenyl)benzene. InChIKey: UDLFZSMUCCUOOS-UHFFFAOYSA-N.

Identity
Molecular formulaC16H18
Molecular weight210.31 g/mol
IUPAC name1,3,5-trimethyl-2-(4-methylphenyl)benzene
InChIKeyUDLFZSMUCCUOOS-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)C2=C(C=C(C=C2C)C)C

Computed by PubChem (NCBI)