CAS 4920-95-0 appears in our catalog under these names: 3,3',4,4'-Tetramethylbiphenyl, 98%, 3，3'，4，4'–Tetramethylbiphenyl, 3,3',4,4'-Tetramethylbiphenyl, 98% . Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Fluorochem. Available pack sizes: 1g, 5g, 250mg.
4-(3,4-dimethylphenyl)-1,2-dimethylbenzene (CAS 4920-95-0) is a chemical compound with the molecular formula C16H18 and a molecular weight of 210.31 g/mol. IUPAC name: 4-(3,4-dimethylphenyl)-1,2-dimethylbenzene. InChIKey: YXBIAYXZUDJVEB-UHFFFAOYSA-N.
| Molecular formula | C16H18 |
|---|---|
| Molecular weight | 210.31 g/mol |
| IUPAC name | 4-(3,4-dimethylphenyl)-1,2-dimethylbenzene |
| InChIKey | YXBIAYXZUDJVEB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CC(=C(C=C2)C)C)C |
Computed by PubChem (NCBI)