CAS 255823-06-4 is the registry number for benzyl (3R,4R)-3-amino-4-(hydroxymethyl)pyrrolidine-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Benzyl (3R,4R)-3-amino-4-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS 255823-06-4) is a chemical compound with the molecular formula C13H18N2O3 and a molecular weight of 250.29 g/mol. IUPAC name: benzyl (3R,4R)-3-amino-4-(hydroxymethyl)pyrrolidine-1-carboxylate. InChIKey: YXCPNFNWSNFFFZ-RYUDHWBXSA-N.
| Molecular formula | C13H18N2O3 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | benzyl (3R,4R)-3-amino-4-(hydroxymethyl)pyrrolidine-1-carboxylate |
| InChIKey | YXCPNFNWSNFFFZ-RYUDHWBXSA-N |
| SMILES | C1[C@H]([C@H](CN1C(=O)OCC2=CC=CC=C2)N)CO |
Computed by PubChem (NCBI)