Products 2560648-06-6
CAS 2560648-06-6 is the registry number for 7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-ol, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-ol (CAS 2560648-06-6) is a chemical compound with the molecular formula C16H19BO3 and a molecular weight of 270.1 g/mol. IUPAC name: 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-ol. InChIKey: CENFCKRYMHRWBQ-UHFFFAOYSA-N.
| Molecular formula | C16H19BO3 |
|---|---|
| Molecular weight | 270.1 g/mol |
| IUPAC name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-ol |
| InChIKey | CENFCKRYMHRWBQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=CC=C3O)C=C2 |
Computed by PubChem (NCBI)