CAS 435280-98-1 is the registry number for N-(2,6-Dimethylphenyl)-1H-benzo(d)imidazol-2-amine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g.
N-(2,6-dimethylphenyl)-1H-benzimidazol-2-amine (CAS 435280-98-1) is a chemical compound with the molecular formula C15H15N3 and a molecular weight of 237.30 g/mol. IUPAC name: N-(2,6-dimethylphenyl)-1H-benzimidazol-2-amine. InChIKey: HZDQKPPIIVQERW-UHFFFAOYSA-N.
| Molecular formula | C15H15N3 |
|---|---|
| Molecular weight | 237.30 g/mol |
| IUPAC name | N-(2,6-dimethylphenyl)-1H-benzimidazol-2-amine |
| InChIKey | HZDQKPPIIVQERW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC2=NC3=CC=CC=C3N2 |
Computed by PubChem (NCBI)