Products 256381-00-7
CAS 256381-00-7 appears in our catalog under these names: tert-Butyl n-[1-(4-bromophenyl)propan-2-yl]carbamate, 95%, tert-Butyl N-(1-(4-bromophenyl)propan-2-yl)carbamate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 5000mg, 1000mg.
Tert-butyl N-[1-(4-bromophenyl)propan-2-yl]carbamate (CAS 256381-00-7) is a chemical compound with the molecular formula C14H20BrNO2 and a molecular weight of 314.22 g/mol. IUPAC name: tert-butyl N-[1-(4-bromophenyl)propan-2-yl]carbamate. InChIKey: LIJWIMYFGXBGMB-UHFFFAOYSA-N.
| Molecular formula | C14H20BrNO2 |
|---|---|
| Molecular weight | 314.22 g/mol |
| IUPAC name | tert-butyl N-[1-(4-bromophenyl)propan-2-yl]carbamate |
| InChIKey | LIJWIMYFGXBGMB-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC=C(C=C1)Br)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)