CAS 1191063-30-5 is the registry number for tert-Butyl 4-bromophenethyl(methyl)carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl N-[2-(4-bromophenyl)ethyl]-N-methylcarbamate (CAS 1191063-30-5) is a chemical compound with the molecular formula C14H20BrNO2 and a molecular weight of 314.22 g/mol. IUPAC name: tert-butyl N-[2-(4-bromophenyl)ethyl]-N-methylcarbamate. InChIKey: WWQRHCQPQUHKFR-UHFFFAOYSA-N.
| Molecular formula | C14H20BrNO2 |
|---|---|
| Molecular weight | 314.22 g/mol |
| IUPAC name | tert-butyl N-[2-(4-bromophenyl)ethyl]-N-methylcarbamate |
| InChIKey | WWQRHCQPQUHKFR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)CCC1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)