Products 2279124-32-0

CAS 2279124-32-0 is the registry number for (5-Bromo-2-methyl-benzyl)-methyl-carbamic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(5-bromo-2-methylphenyl)methyl]-N-methylcarbamate (CAS 2279124-32-0) is a chemical compound with the molecular formula C14H20BrNO2 and a molecular weight of 314.22 g/mol. IUPAC name: tert-butyl N-[(5-bromo-2-methylphenyl)methyl]-N-methylcarbamate. InChIKey: BWZJHIZYQVIZHM-UHFFFAOYSA-N.

Identity
Molecular formulaC14H20BrNO2
Molecular weight314.22 g/mol
IUPAC nametert-butyl N-[(5-bromo-2-methylphenyl)methyl]-N-methylcarbamate
InChIKeyBWZJHIZYQVIZHM-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)Br)CN(C)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)