CAS 1133115-32-8 is the registry number for N-BOC-N-isopropyl 4-bromoaniline, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Tert-butyl N-(4-bromophenyl)-N-propan-2-ylcarbamate (CAS 1133115-32-8) is a chemical compound with the molecular formula C14H20BrNO2 and a molecular weight of 314.22 g/mol. IUPAC name: tert-butyl N-(4-bromophenyl)-N-propan-2-ylcarbamate. InChIKey: GGCWJHRAPQNBDE-UHFFFAOYSA-N.
| Molecular formula | C14H20BrNO2 |
|---|---|
| Molecular weight | 314.22 g/mol |
| IUPAC name | tert-butyl N-(4-bromophenyl)-N-propan-2-ylcarbamate |
| InChIKey | GGCWJHRAPQNBDE-UHFFFAOYSA-N |
| SMILES | CC(C)N(C1=CC=C(C=C1)Br)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)