Products 256446-70-5
CAS 256446-70-5 is the registry number for (2R)-1-benzyloxycarbonylazepane-2-carboxylic acid, 96%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
(2R)-1-phenylmethoxycarbonylazepane-2-carboxylic acid (CAS 256446-70-5) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: (2R)-1-phenylmethoxycarbonylazepane-2-carboxylic acid. InChIKey: GIZKFGHPTHSCIX-CYBMUJFWSA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | (2R)-1-phenylmethoxycarbonylazepane-2-carboxylic acid |
| InChIKey | GIZKFGHPTHSCIX-CYBMUJFWSA-N |
| SMILES | C1CC[C@@H](N(CC1)C(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(2R)-1-benzyloxycarbonylazepane-2-carboxylic acid, (R)-1-((Benzyloxy)carbonyl)azepane-2-carboxylic acid, (2R)-1-[(benzyloxy)carbonyl]azepane-2-carboxylic acid, (2R)-1-Cbzazepane-2-carboxylic Acid, (2R)-Azepane-1,2-dicarboxylic acid 1-benzyl ester, (2R)-1-phenylmethoxycarbonylazepane-2-carboxylic acid