Products 256461-28-6
CAS 256461-28-6 is the registry number for FR221647. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(2R)-1-hydroxy-4-phenylbutan-2-yl]imidazole-4-carboxamide (CAS 256461-28-6) is a chemical compound with the molecular formula C14H17N3O2 and a molecular weight of 259.30 g/mol. IUPAC name: 1-[(2R)-1-hydroxy-4-phenylbutan-2-yl]imidazole-4-carboxamide. InChIKey: ZUYUIKKHHBEVHL-GFCCVEGCSA-N.
| Molecular formula | C14H17N3O2 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | 1-[(2R)-1-hydroxy-4-phenylbutan-2-yl]imidazole-4-carboxamide |
| InChIKey | ZUYUIKKHHBEVHL-GFCCVEGCSA-N |
| SMILES | C1=CC=C(C=C1)CC[C@H](CO)N2C=C(N=C2)C(=O)N |
Computed by PubChem (NCBI)