CAS 2565792-56-3 is the registry number for (8R)-8-Amino-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 1g.
(8R)-8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid;hydrochloride (CAS 2565792-56-3) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: (8R)-8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid;hydrochloride. InChIKey: DKBYUNKLGBPKMG-HNCPQSOCSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | (8R)-8-amino-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid;hydrochloride |
| InChIKey | DKBYUNKLGBPKMG-HNCPQSOCSA-N |
| SMILES | C1C[C@H](C2=C(C1)C=CC(=C2)C(=O)O)N.Cl |
Computed by PubChem (NCBI)