Products 2567067-10-9
CAS 2567067-10-9 is the registry number for 6-Bromo-1-(tetrahydro-2H-pyran-2-yl)-1H-indazole-4-carbaldehyde, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
6-bromo-1-(oxan-2-yl)indazole-4-carbaldehyde (CAS 2567067-10-9) is a chemical compound with the molecular formula C13H13BrN2O2 and a molecular weight of 309.16 g/mol. IUPAC name: 6-bromo-1-(oxan-2-yl)indazole-4-carbaldehyde. InChIKey: HZHMLXNEFGEEJC-UHFFFAOYSA-N.
| Molecular formula | C13H13BrN2O2 |
|---|---|
| Molecular weight | 309.16 g/mol |
| IUPAC name | 6-bromo-1-(oxan-2-yl)indazole-4-carbaldehyde |
| InChIKey | HZHMLXNEFGEEJC-UHFFFAOYSA-N |
| SMILES | C1CCOC(C1)N2C3=CC(=CC(=C3C=N2)C=O)Br |
Computed by PubChem (NCBI)