CAS 2577388-38-4 appears in our catalog under these names: Anti–inflammatory agent 32, Anti-inflammatory agent 32, 99%, 99%, Anti-inflammatory agent 32, 99.52%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 1mg, 5mg, 10 mg, 25 mg, 100 mg, 10mM/1mL.
(E)-3-(3,4-dihydroxyphenyl)-1-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]prop-2-en-1-one (CAS 2577388-38-4) is a chemical compound with the molecular formula C20H20O4 and a molecular weight of 324.4 g/mol. IUPAC name: (E)-3-(3,4-dihydroxyphenyl)-1-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]prop-2-en-1-one. InChIKey: RXNYTCNRGLMQSL-XBXARRHUSA-N.
| Molecular formula | C20H20O4 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | (E)-3-(3,4-dihydroxyphenyl)-1-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]prop-2-en-1-one |
| InChIKey | RXNYTCNRGLMQSL-XBXARRHUSA-N |
| SMILES | CC(=CCC1=C(C=CC(=C1)C(=O)/C=C/C2=CC(=C(C=C2)O)O)O)C |
Computed by PubChem (NCBI)