Products 2581529-01-1
CAS 2581529-01-1 is the registry number for 1-(5-Chloro-1,8-naphthyridin-2-yl)ethan-1-ol. Offered by: TRC. Available pack sizes: 75mg.
1-(5-chloro-1,8-naphthyridin-2-yl)ethanol (CAS 2581529-01-1) is a chemical compound with the molecular formula C10H9ClN2O and a molecular weight of 208.64 g/mol. IUPAC name: 1-(5-chloro-1,8-naphthyridin-2-yl)ethanol. InChIKey: FNZFAZNGQJCDSA-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | 1-(5-chloro-1,8-naphthyridin-2-yl)ethanol |
| InChIKey | FNZFAZNGQJCDSA-UHFFFAOYSA-N |
| SMILES | CC(C1=NC2=NC=CC(=C2C=C1)Cl)O |
Computed by PubChem (NCBI)