Products 258327-78-5
CAS 258327-78-5 is the registry number for 2,9-Dimethyl-1,10-phenanthroline-5,6-diamine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2,9-dimethyl-1,10-phenanthroline-5,6-diamine (CAS 258327-78-5) is a chemical compound with the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. IUPAC name: 2,9-dimethyl-1,10-phenanthroline-5,6-diamine. InChIKey: PTQBIQOWYRUTSR-UHFFFAOYSA-N.
| Molecular formula | C14H14N4 |
|---|---|
| Molecular weight | 238.29 g/mol |
| IUPAC name | 2,9-dimethyl-1,10-phenanthroline-5,6-diamine |
| InChIKey | PTQBIQOWYRUTSR-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C3C(=C(C(=C2C=C1)N)N)C=CC(=N3)C |
Computed by PubChem (NCBI)