Products 2585198-85-0
CAS 2585198-85-0 is the registry number for FTO-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-(2-methoxypyrimidin-5-yl)naphthalen-2-ol (CAS 2585198-85-0) is a chemical compound with the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. IUPAC name: 6-(2-methoxypyrimidin-5-yl)naphthalen-2-ol. InChIKey: YIRPEFJLKJLCII-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O2 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 6-(2-methoxypyrimidin-5-yl)naphthalen-2-ol |
| InChIKey | YIRPEFJLKJLCII-UHFFFAOYSA-N |
| SMILES | COC1=NC=C(C=N1)C2=CC3=C(C=C2)C=C(C=C3)O |
Computed by PubChem (NCBI)