Products 2586125-92-8
CAS 2586125-92-8 is the registry number for 4-(3,5-Dibromobenzyl)benzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
4-[(3,5-dibromophenyl)methyl]benzaldehyde (CAS 2586125-92-8) is a chemical compound with the molecular formula C14H10Br2O and a molecular weight of 354.04 g/mol. IUPAC name: 4-[(3,5-dibromophenyl)methyl]benzaldehyde. InChIKey: TVYDZRDNMGNSEF-UHFFFAOYSA-N.
| Molecular formula | C14H10Br2O |
|---|---|
| Molecular weight | 354.04 g/mol |
| IUPAC name | 4-[(3,5-dibromophenyl)methyl]benzaldehyde |
| InChIKey | TVYDZRDNMGNSEF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=CC(=CC(=C2)Br)Br)C=O |
Computed by PubChem (NCBI)