CAS 28179-30-8 is the registry number for 1-([1,1'-Biphenyl]-4-yl)-2,2-dibromoethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dibromo-1-(4-phenylphenyl)ethanone (CAS 28179-30-8) is a chemical compound with the molecular formula C14H10Br2O and a molecular weight of 354.04 g/mol. IUPAC name: 2,2-dibromo-1-(4-phenylphenyl)ethanone. InChIKey: VHMQXWDTZAUVLO-UHFFFAOYSA-N.
| Molecular formula | C14H10Br2O |
|---|---|
| Molecular weight | 354.04 g/mol |
| IUPAC name | 2,2-dibromo-1-(4-phenylphenyl)ethanone |
| InChIKey | VHMQXWDTZAUVLO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)C(Br)Br |
Computed by PubChem (NCBI)