CAS 94512-73-9 is the registry number for 2-Bromo-1-(4-(4-bromophenyl)phenyl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-bromo-1-[4-(4-bromophenyl)phenyl]ethanone (CAS 94512-73-9) is a chemical compound with the molecular formula C14H10Br2O and a molecular weight of 354.04 g/mol. IUPAC name: 2-bromo-1-[4-(4-bromophenyl)phenyl]ethanone. InChIKey: MHUAWTIXPZEHRL-UHFFFAOYSA-N.
| Molecular formula | C14H10Br2O |
|---|---|
| Molecular weight | 354.04 g/mol |
| IUPAC name | 2-bromo-1-[4-(4-bromophenyl)phenyl]ethanone |
| InChIKey | MHUAWTIXPZEHRL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)Br)C(=O)CBr |
Computed by PubChem (NCBI)