CAS 74316-23-7 appears in our catalog under these names: (2,7-Dibromo-9h-fluoren-9-yl)methanol, 95%, 2,7-Dibromo-9-(hydroxymethyl)fluorene, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
(2,7-dibromo-9H-fluoren-9-yl)methanol (CAS 74316-23-7) is a chemical compound with the molecular formula C14H10Br2O and a molecular weight of 354.04 g/mol. IUPAC name: (2,7-dibromo-9H-fluoren-9-yl)methanol. InChIKey: BFCUXRMYZQMDEP-UHFFFAOYSA-N.
| Molecular formula | C14H10Br2O |
|---|---|
| Molecular weight | 354.04 g/mol |
| IUPAC name | (2,7-dibromo-9H-fluoren-9-yl)methanol |
| InChIKey | BFCUXRMYZQMDEP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(C3=C2C=CC(=C3)Br)CO |
Computed by PubChem (NCBI)