Products 2586826-19-7
CAS 2586826-19-7 is the registry number for 7-Chloro-2-(1,1-dioxidotetrahydrothiophen-3-yl)phthalazin-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-2-(1,1-dioxothiolan-3-yl)phthalazin-1-one (CAS 2586826-19-7) is a chemical compound with the molecular formula C12H11ClN2O3S and a molecular weight of 298.75 g/mol. IUPAC name: 7-chloro-2-(1,1-dioxothiolan-3-yl)phthalazin-1-one. InChIKey: IWKZAKXUYJTRGJ-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O3S |
|---|---|
| Molecular weight | 298.75 g/mol |
| IUPAC name | 7-chloro-2-(1,1-dioxothiolan-3-yl)phthalazin-1-one |
| InChIKey | IWKZAKXUYJTRGJ-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1N2C(=O)C3=C(C=CC(=C3)Cl)C=N2 |
Computed by PubChem (NCBI)