Products 64910-68-5
CAS 64910-68-5 appears in our catalog under these names: 3-Amino-4-chloro-benzenesulfonic acid 4-amino-phenyl ester, 95%, 3-Amino-4-chloro-benzenesulfonic acid 4-amino-phenyl ester. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
(4-aminophenyl) 3-amino-4-chlorobenzenesulfonate (CAS 64910-68-5) is a chemical compound with the molecular formula C12H11ClN2O3S and a molecular weight of 298.75 g/mol. IUPAC name: (4-aminophenyl) 3-amino-4-chlorobenzenesulfonate. InChIKey: COMDKLMEFBOYIJ-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O3S |
|---|---|
| Molecular weight | 298.75 g/mol |
| IUPAC name | (4-aminophenyl) 3-amino-4-chlorobenzenesulfonate |
| InChIKey | COMDKLMEFBOYIJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)OS(=O)(=O)C2=CC(=C(C=C2)Cl)N |
Computed by PubChem (NCBI)