Products 409357-24-0

CAS 409357-24-0 is the registry number for Sulfasalazine Impurity 24. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

4-chloro-3-methoxy-N-pyridin-2-ylbenzenesulfonamide (CAS 409357-24-0) is a chemical compound with the molecular formula C12H11ClN2O3S and a molecular weight of 298.75 g/mol. IUPAC name: 4-chloro-3-methoxy-N-pyridin-2-ylbenzenesulfonamide. InChIKey: YDFWVQDTODNHNL-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11ClN2O3S
Molecular weight298.75 g/mol
IUPAC name4-chloro-3-methoxy-N-pyridin-2-ylbenzenesulfonamide
InChIKeyYDFWVQDTODNHNL-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1)S(=O)(=O)NC2=CC=CC=N2)Cl

Computed by PubChem (NCBI)