CAS 328028-38-2 appears in our catalog under these names: 3-Amino-n-(3-chloro-phenyl)-4-hydroxy-benzenesulfonamide, 95%, 3-Amino-N-(3-chlorophenyl)-4-hydroxybenzene-1-sulfonamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
3-amino-N-(3-chlorophenyl)-4-hydroxybenzenesulfonamide (CAS 328028-38-2) is a chemical compound with the molecular formula C12H11ClN2O3S and a molecular weight of 298.75 g/mol. IUPAC name: 3-amino-N-(3-chlorophenyl)-4-hydroxybenzenesulfonamide. InChIKey: ANLCKXQKXHOMGI-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O3S |
|---|---|
| Molecular weight | 298.75 g/mol |
| IUPAC name | 3-amino-N-(3-chlorophenyl)-4-hydroxybenzenesulfonamide |
| InChIKey | ANLCKXQKXHOMGI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)NS(=O)(=O)C2=CC(=C(C=C2)O)N |
Computed by PubChem (NCBI)