CAS 25888-09-9 is the registry number for Arbidol Impurity 15. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
5-acetyloxy-1,2-dimethylindole-3-carboxylic acid (CAS 25888-09-9) is a chemical compound with the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. IUPAC name: 5-acetyloxy-1,2-dimethylindole-3-carboxylic acid. InChIKey: IRBIBCFFLNUITC-UHFFFAOYSA-N.
| Molecular formula | C13H13NO4 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | 5-acetyloxy-1,2-dimethylindole-3-carboxylic acid |
| InChIKey | IRBIBCFFLNUITC-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1C)C=CC(=C2)OC(=O)C)C(=O)O |
Computed by PubChem (NCBI)