CAS 2592-05-4 appears in our catalog under these names: 1H-Indole-3-carbaldehyde oxime, 98%, 1H-Indole-3-carbaldehyde oxime, 95-<97%, 1H-Indole-3-carbaldehyde oxime, ≥97-<99%, 1H-Indole-3-carbaldehyde oxime, 97%, 1H–Indole–3–carboxaldehyde Oxime. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed, GLPBio, TCI. Available pack sizes: 250mg, 5g, 1g, 25g, 50g, 100g, 200g, 300g.
(NE)-N-(1H-indol-3-ylmethylidene)hydroxylamine (CAS 2592-05-4) is a chemical compound with the molecular formula C9H8N2O and a molecular weight of 160.17 g/mol. IUPAC name: (NE)-N-(1H-indol-3-ylmethylidene)hydroxylamine. InChIKey: BWEFEUTYNRSOKX-IZZDOVSWSA-N.
| Molecular formula | C9H8N2O |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | (NE)-N-(1H-indol-3-ylmethylidene)hydroxylamine |
| InChIKey | BWEFEUTYNRSOKX-IZZDOVSWSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)/C=N/O |
Computed by PubChem (NCBI)