CAS 2592436-21-8 appears in our catalog under these names: GRK2 Inhibitor 2, GRK2 Inhibitor 2, 99.92%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, 10 mg, 10mM/1mL, 5 mg, 25 mg.
2-[(3-methoxyphenyl)methyl]-7-(1H-pyrazol-4-yl)phthalazin-1-one (CAS 2592436-21-8) is a chemical compound with the molecular formula C19H16N4O2 and a molecular weight of 332.4 g/mol. IUPAC name: 2-[(3-methoxyphenyl)methyl]-7-(1H-pyrazol-4-yl)phthalazin-1-one. InChIKey: CYINSAOYPJZRPS-UHFFFAOYSA-N.
| Molecular formula | C19H16N4O2 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 2-[(3-methoxyphenyl)methyl]-7-(1H-pyrazol-4-yl)phthalazin-1-one |
| InChIKey | CYINSAOYPJZRPS-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)CN2C(=O)C3=C(C=CC(=C3)C4=CNN=C4)C=N2 |
Computed by PubChem (NCBI)