Products 879593-54-1
CAS 879593-54-1 is the registry number for SDR-04. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-2-methoxyphenol (CAS 879593-54-1) is a chemical compound with the molecular formula C19H16N4O2 and a molecular weight of 332.4 g/mol. IUPAC name: 4-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-2-methoxyphenol. InChIKey: KZMVPUIBSUVYJZ-UHFFFAOYSA-N.
| Molecular formula | C19H16N4O2 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 4-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-2-methoxyphenol |
| InChIKey | KZMVPUIBSUVYJZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C2=C(N3C=CN=CC3=N2)NC4=CC=CC=C4)O |
Computed by PubChem (NCBI)