Products 690697-43-9
CAS 690697-43-9 appears in our catalog under these names: WAY-309236-A, WAY–309236–A, WAY-309236 98%, WAY-309236, 98%, 98%, WAY-309236, 98.0%. Offered by: Chemat Brand, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: on request, 25mg, 5mg, 10mg, 50mg, 100mg, 250mg, 10 mg.
3-[[4-(furan-2-ylmethylamino)quinazolin-2-yl]amino]phenol (CAS 690697-43-9) is a chemical compound with the molecular formula C19H16N4O2 and a molecular weight of 332.4 g/mol. IUPAC name: 3-[[4-(furan-2-ylmethylamino)quinazolin-2-yl]amino]phenol. InChIKey: PRZVJFFQEBFBKT-UHFFFAOYSA-N.
| Molecular formula | C19H16N4O2 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 3-[[4-(furan-2-ylmethylamino)quinazolin-2-yl]amino]phenol |
| InChIKey | PRZVJFFQEBFBKT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC(=N2)NC3=CC(=CC=C3)O)NCC4=CC=CO4 |
Computed by PubChem (NCBI)