CAS 300816-12-0 is the registry number for ZINC00230567, 99.69%. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[2-oxo-2-phenyl-1-(pyrimidin-2-ylamino)ethyl]benzamide (CAS 300816-12-0) is a chemical compound with the molecular formula C19H16N4O2 and a molecular weight of 332.4 g/mol. IUPAC name: N-[2-oxo-2-phenyl-1-(pyrimidin-2-ylamino)ethyl]benzamide. InChIKey: SQRPBDFYIVAQSB-UHFFFAOYSA-N.
| Molecular formula | C19H16N4O2 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | N-[2-oxo-2-phenyl-1-(pyrimidin-2-ylamino)ethyl]benzamide |
| InChIKey | SQRPBDFYIVAQSB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C(NC2=NC=CC=N2)NC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)