CAS 2593-89-7 appears in our catalog under these names: 2-(2-Chlorophenyl)-N-hydroxyacetamide, 95%, 2-(2-Chlorophenyl)-N-hydroxyacetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-(2-chlorophenyl)-N-hydroxyacetamide (CAS 2593-89-7) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: 2-(2-chlorophenyl)-N-hydroxyacetamide. InChIKey: TYKWNWMLKNCDRI-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-N-hydroxyacetamide |
| InChIKey | TYKWNWMLKNCDRI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)NO)Cl |
Computed by PubChem (NCBI)