CAS 259809-46-6 is the registry number for 6–Boc–5,6,7,8–tetrahydro–1,6–naphthyridine–2–carbonitrile. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
Tert-butyl 2-cyano-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate (CAS 259809-46-6) is a chemical compound with the molecular formula C14H17N3O2 and a molecular weight of 259.30 g/mol. IUPAC name: tert-butyl 2-cyano-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate. InChIKey: FYOTYCXSXHSVHN-UHFFFAOYSA-N.
| Molecular formula | C14H17N3O2 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | tert-butyl 2-cyano-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate |
| InChIKey | FYOTYCXSXHSVHN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)C=CC(=N2)C#N |
Computed by PubChem (NCBI)