Products 2602402-33-3
CAS 2602402-33-3 is the registry number for isopropyl 3-oxo-2-oxa-4-azabicyclo[3.1.1]heptane-5-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Propan-2-yl 3-oxo-2-oxa-4-azabicyclo[3.1.1]heptane-5-carboxylate (CAS 2602402-33-3) is a chemical compound with the molecular formula C9H13NO4 and a molecular weight of 199.20 g/mol. IUPAC name: propan-2-yl 3-oxo-2-oxa-4-azabicyclo[3.1.1]heptane-5-carboxylate. InChIKey: UEBWDPZRAODRIT-UHFFFAOYSA-N.
| Molecular formula | C9H13NO4 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | propan-2-yl 3-oxo-2-oxa-4-azabicyclo[3.1.1]heptane-5-carboxylate |
| InChIKey | UEBWDPZRAODRIT-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C12CC(C1)OC(=O)N2 |
Computed by PubChem (NCBI)