Products 2606946-08-9
CAS 2606946-08-9 is the registry number for 4-Bromo-1,3,3-trimethylindoline-6-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-1,3,3-trimethyl-2H-indole-6-carboxylic acid (CAS 2606946-08-9) is a chemical compound with the molecular formula C12H14BrNO2 and a molecular weight of 284.15 g/mol. IUPAC name: 4-bromo-1,3,3-trimethyl-2H-indole-6-carboxylic acid. InChIKey: UIRQLZFTEHMHLI-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO2 |
|---|---|
| Molecular weight | 284.15 g/mol |
| IUPAC name | 4-bromo-1,3,3-trimethyl-2H-indole-6-carboxylic acid |
| InChIKey | UIRQLZFTEHMHLI-UHFFFAOYSA-N |
| SMILES | CC1(CN(C2=C1C(=CC(=C2)C(=O)O)Br)C)C |
Computed by PubChem (NCBI)