CAS 26078-25-1 appears in our catalog under these names: Coumarin 2, 95%, 4,6–Dimethyl–7–ethylaminocoumarin, 7-(Ethylamino)-4,6-dimethylcoumarin, >98.0%(GC), Coumarin 2, 99%, laser grade, 4,6-Dimethyl-7-ethylaminocoumarin 98%. Offered by: Combi-blocks, GLPBio, TCI, Thermo Scientific (Acros), Ambeed. Available pack sizes: 1g, 200mg, 500MG, 100mg, 250mg, 250 mg, 1 g, 100 mg.
7-(ethylamino)-4,6-dimethylchromen-2-one (CAS 26078-25-1) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: 7-(ethylamino)-4,6-dimethylchromen-2-one. InChIKey: QZXAEJGHNXJTSE-UHFFFAOYSA-N.
| Molecular formula | C13H15NO2 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 7-(ethylamino)-4,6-dimethylchromen-2-one |
| InChIKey | QZXAEJGHNXJTSE-UHFFFAOYSA-N |
| SMILES | CCNC1=CC2=C(C=C1C)C(=CC(=O)O2)C |
Computed by PubChem (NCBI)