Products 260968-87-4
CAS 260968-87-4 is the registry number for Methyl 2-chloro-4-(chlorosulfonyl)benzoate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Methyl 2-chloro-4-chlorosulfonylbenzoate (CAS 260968-87-4) is a chemical compound with the molecular formula C8H6Cl2O4S and a molecular weight of 269.10 g/mol. IUPAC name: methyl 2-chloro-4-chlorosulfonylbenzoate. InChIKey: OFLIXGSTZSJGRB-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O4S |
|---|---|
| Molecular weight | 269.10 g/mol |
| IUPAC name | methyl 2-chloro-4-chlorosulfonylbenzoate |
| InChIKey | OFLIXGSTZSJGRB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)