Products 261-27-8
CAS 261-27-8 appears in our catalog under these names: 5H–(1)Benzopyrano(2，3–b)pyridine, 5H-chromeno(2,3-b)pyridine, 5H-Chromeno[2,3-b]pyridine 98%, 5H-[1]Benzopyrano[2,3-b]pyridine, 98%, 98%, 5H-Chromeno[2,3-b]pyridine, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 1000g, 100g, 500g, 100mg, 250mg.
5H-chromeno[2,3-b]pyridine (CAS 261-27-8) is a chemical compound with the molecular formula C12H9NO and a molecular weight of 183.21 g/mol. IUPAC name: 5H-chromeno[2,3-b]pyridine. InChIKey: MXIYRNSRKGMBLQ-UHFFFAOYSA-N.
| Molecular formula | C12H9NO |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | 5H-chromeno[2,3-b]pyridine |
| InChIKey | MXIYRNSRKGMBLQ-UHFFFAOYSA-N |
| SMILES | C1C2=C(N=CC=C2)OC3=CC=CC=C31 |
Computed by PubChem (NCBI)