Products 302345-89-7
CAS 302345-89-7 appears in our catalog under these names: 3-(3-Phenylprop-2-enamido)propanoic acid, 95%, 3-(3-Phenylprop-2-enamido)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 0,5g, 5g.
3-[[(E)-3-phenylprop-2-enoyl]amino]propanoic acid (CAS 302345-89-7) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: 3-[[(E)-3-phenylprop-2-enoyl]amino]propanoic acid. InChIKey: RHVXIMHTRDBXMQ-VOTSOKGWSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 3-[[(E)-3-phenylprop-2-enoyl]amino]propanoic acid |
| InChIKey | RHVXIMHTRDBXMQ-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)NCCC(=O)O |
Computed by PubChem (NCBI)