CAS 261380-18-1 is the registry number for (R)-2-((tert-Butoxycarbonyl)amino)-3-(furan-2-yl)propanoic acid, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
(2R)-3-(furan-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 261380-18-1) is a chemical compound with the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. IUPAC name: (2R)-3-(furan-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: YWLUWSMJXXBOLV-SECBINFHSA-N.
| Molecular formula | C12H17NO5 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | (2R)-3-(furan-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | YWLUWSMJXXBOLV-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=CO1)C(=O)O |
Computed by PubChem (NCBI)