CAS 2616551-97-2 is the registry number for 6-Hydroxy-6,7-dihydro-1H-indeno[5,6-c]furan-1,3(5H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-hydroxy-6,7-dihydro-5H-cyclopenta[f][2]benzofuran-1,3-dione (CAS 2616551-97-2) is a chemical compound with the molecular formula C11H8O4 and a molecular weight of 204.18 g/mol. IUPAC name: 6-hydroxy-6,7-dihydro-5H-cyclopenta[f][2]benzofuran-1,3-dione. InChIKey: AYXXFDPJBPCRJB-UHFFFAOYSA-N.
| Molecular formula | C11H8O4 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 6-hydroxy-6,7-dihydro-5H-cyclopenta[f][2]benzofuran-1,3-dione |
| InChIKey | AYXXFDPJBPCRJB-UHFFFAOYSA-N |
| SMILES | C1C(CC2=CC3=C(C=C21)C(=O)OC3=O)O |
Computed by PubChem (NCBI)