Products 2616668-32-5

CAS 2616668-32-5 is the registry number for 4-(Benzyloxy)-3-(methylsulfonamido)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(methanesulfonamido)-4-phenylmethoxybenzoic acid (CAS 2616668-32-5) is a chemical compound with the molecular formula C15H15NO5S and a molecular weight of 321.3 g/mol. IUPAC name: 3-(methanesulfonamido)-4-phenylmethoxybenzoic acid. InChIKey: DLWHXJNEKLXGCQ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H15NO5S
Molecular weight321.3 g/mol
IUPAC name3-(methanesulfonamido)-4-phenylmethoxybenzoic acid
InChIKeyDLWHXJNEKLXGCQ-UHFFFAOYSA-N
SMILESCS(=O)(=O)NC1=C(C=CC(=C1)C(=O)O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)