CAS 261762-93-0 appears in our catalog under these names: 6-Chloro-2-fluoro-3-methylphenylacetic acid, 95%, 6–Chloro–2–Fluoro–3–Methylphenylacetic Acid, 2-(6-Chloro-2-fluoro-3-methylphenyl)acetic acid, 98%, 98%, 6-Chloro-2-fluoro-3-methylphenylacetic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 10mg, 100mg, 5g.
2-(6-chloro-2-fluoro-3-methylphenyl)acetic acid (CAS 261762-93-0) is a chemical compound with the molecular formula C9H8ClFO2 and a molecular weight of 202.61 g/mol. IUPAC name: 2-(6-chloro-2-fluoro-3-methylphenyl)acetic acid. InChIKey: WVPCYTGXJQYSCV-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO2 |
|---|---|
| Molecular weight | 202.61 g/mol |
| IUPAC name | 2-(6-chloro-2-fluoro-3-methylphenyl)acetic acid |
| InChIKey | WVPCYTGXJQYSCV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)Cl)CC(=O)O)F |
Computed by PubChem (NCBI)